C24H27NO3S — CID 9017878
[2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] adamantane-1-carboxylate (PubChem CID 9017878) has the molecular formula C24H27NO3S and a molecular weight of 409.55 g/mol. Its IUPAC name is [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] adamantane-1-carboxylate.
| Compound Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 9017878 |
| Molecular Formula | C24H27NO3S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | [2-oxo-2-[[(R)-phenyl(thiophen-2-yl)methyl]amino]ethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)N[C@H](c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H27NO3S/c26-21(25-22(20-7-4-8-29-20)19-5-2-1-3-6-19)15-28-23(27)24-12-16-9-17(13-24)11-18(10-16)14-24/h1-8,16-18,22H,9-15H2,(H,25,26)/t16?,17?,18?,22-,24?/m1/s1 |
| InChIKey | FBICWYVFNIRGTE-YFZSMNHSSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |