C23H22N2O3S — CID 55391592
2-(4-cyano-2-ethoxyphenoxy)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide (PubChem CID 55391592) has the molecular formula C23H22N2O3S and a molecular weight of 406.51 g/mol. Its IUPAC name is 2-(4-cyano-2-ethoxyphenoxy)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide.
| Compound Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide |
|---|---|
| PubChem CID | 55391592 |
| Molecular Formula | C23H22N2O3S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-(4-cyano-2-ethoxyphenoxy)-N-[(4-methylphenyl)-thiophen-2-ylmethyl]acetamide |
| SMILES | CCOc1cc(C#N)ccc1OCC(=O)NC(c1ccc(C)cc1)c1cccs1 |
| InChI | InChI=1S/C23H22N2O3S/c1-3-27-20-13-17(14-24)8-11-19(20)28-15-22(26)25-23(21-5-4-12-29-21)18-9-6-16(2)7-10-18/h4-13,23H,3,15H2,1-2H3,(H,25,26) |
| InChIKey | JXTSWVOKSNJNQD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |