C20H16N2O2S — CID 9012921
2-(4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 9012921) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 9012921 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | N#Cc1ccc(OCC(=O)N[C@@H](c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C20H16N2O2S/c21-13-15-8-10-17(11-9-15)24-14-19(23)22-20(18-7-4-12-25-18)16-5-2-1-3-6-16/h1-12,20H,14H2,(H,22,23)/t20-/m0/s1 |
| InChIKey | CHOCGHBCWRXEHP-FQEVSTJZSA-N |
| XLogP | 3.90 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |