C17H16N2O4S — CID 94175254
methyl (3S)-3-[[2-(4-cyanophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 94175254) has the molecular formula C17H16N2O4S and a molecular weight of 344.39 g/mol. Its IUPAC name is methyl (3S)-3-[[2-(4-cyanophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3S)-3-[[2-(4-cyanophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 94175254 |
| Molecular Formula | C17H16N2O4S |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | methyl (3S)-3-[[2-(4-cyanophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@H](NC(=O)COc1ccc(C#N)cc1)c1cccs1 |
| InChI | InChI=1S/C17H16N2O4S/c1-22-17(21)9-14(15-3-2-8-24-15)19-16(20)11-23-13-6-4-12(10-18)5-7-13/h2-8,14H,9,11H2,1H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | ZJKLJIPHTZFRCZ-AWEZNQCLSA-N |
| XLogP | 2.42 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |