C16H15BrFNO4S — CID 30371712
methyl (3S)-3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate (PubChem CID 30371712) has the molecular formula C16H15BrFNO4S and a molecular weight of 416.27 g/mol. Its IUPAC name is methyl (3S)-3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3S)-3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 30371712 |
| Molecular Formula | C16H15BrFNO4S |
| Molecular Weight | 416.27 g/mol |
| Exact Mass | 414.99 |
| IUPAC Name | methyl (3S)-3-[[2-(4-bromo-2-fluorophenoxy)acetyl]amino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@H](NC(=O)COc1ccc(Br)cc1F)c1cccs1 |
| InChI | InChI=1S/C16H15BrFNO4S/c1-22-16(21)8-12(14-3-2-6-24-14)19-15(20)9-23-13-5-4-10(17)7-11(13)18/h2-7,12H,8-9H2,1H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | LGPQUZLGTKYLEJ-LBPRGKRZSA-N |
| XLogP | 3.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.27 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |