C14H14N2O2S2 — CID 79614184
methyl 3-[(4-cyanothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoate (PubChem CID 79614184) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is methyl 3-[(4-cyanothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl 3-[(4-cyanothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 79614184 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | methyl 3-[(4-cyanothiophen-2-yl)methylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)CC(NCc1cc(C#N)cs1)c1cccs1 |
| InChI | InChI=1S/C14H14N2O2S2/c1-18-14(17)6-12(13-3-2-4-19-13)16-8-11-5-10(7-15)9-20-11/h2-5,9,12,16H,6,8H2,1H3 |
| InChIKey | HYNFOANFWDVKEF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |