C15H16N2S — CID 79553082
5-[(1-phenylpropylamino)methyl]thiophene-3-carbonitrile (PubChem CID 79553082) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 5-[(1-phenylpropylamino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(1-phenylpropylamino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79553082 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-[(1-phenylpropylamino)methyl]thiophene-3-carbonitrile |
| SMILES | CCC(NCc1cc(C#N)cs1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2S/c1-2-15(13-6-4-3-5-7-13)17-10-14-8-12(9-16)11-18-14/h3-8,11,15,17H,2,10H2,1H3 |
| InChIKey | FUVAKRAHPLUSME-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |