C12H18N2S — CID 79614341
5-[(4-methylpentan-2-ylamino)methyl]thiophene-3-carbonitrile (PubChem CID 79614341) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 5-[(4-methylpentan-2-ylamino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(4-methylpentan-2-ylamino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79614341 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5-[(4-methylpentan-2-ylamino)methyl]thiophene-3-carbonitrile |
| SMILES | CC(C)CC(C)NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C12H18N2S/c1-9(2)4-10(3)14-7-12-5-11(6-13)8-15-12/h5,8-10,14H,4,7H2,1-3H3 |
| InChIKey | HQFRVJYBRFBKGD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |