C17H27N3O2S — CID 103724191
tert-butyl N-[2-[(4-cyanothiophen-2-yl)methylamino]-4-methylpentyl]carbamate (PubChem CID 103724191) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is tert-butyl N-[2-[(4-cyanothiophen-2-yl)methylamino]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[2-[(4-cyanothiophen-2-yl)methylamino]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 103724191 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | tert-butyl N-[2-[(4-cyanothiophen-2-yl)methylamino]-4-methylpentyl]carbamate |
| SMILES | CC(C)CC(CNC(=O)OC(C)(C)C)NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C17H27N3O2S/c1-12(2)6-14(9-20-16(21)22-17(3,4)5)19-10-15-7-13(8-18)11-23-15/h7,11-12,14,19H,6,9-10H2,1-5H3,(H,20,21) |
| InChIKey | RSFODWLLWBUSNK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |