C20H15ClN2O2S — CID 8978027
2-(2-chloro-4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide (PubChem CID 8978027) has the molecular formula C20H15ClN2O2S and a molecular weight of 382.87 g/mol. Its IUPAC name is 2-(2-chloro-4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide.
| Compound Name | 2-(2-chloro-4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 8978027 |
| Molecular Formula | C20H15ClN2O2S |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | 2-(2-chloro-4-cyanophenoxy)-N-[(S)-phenyl(thiophen-2-yl)methyl]acetamide |
| SMILES | N#Cc1ccc(OCC(=O)N[C@@H](c2ccccc2)c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C20H15ClN2O2S/c21-16-11-14(12-22)8-9-17(16)25-13-19(24)23-20(18-7-4-10-26-18)15-5-2-1-3-6-15/h1-11,20H,13H2,(H,23,24)/t20-/m0/s1 |
| InChIKey | KERDUYZZTKCRNJ-FQEVSTJZSA-N |
| XLogP | 4.56 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |