C20H17F2NO2S — CID 16561484
N-[[4-(difluoromethoxy)phenyl]-phenylmethyl]-5-methylthiophene-2-carboxamide (PubChem CID 16561484) has the molecular formula C20H17F2NO2S and a molecular weight of 373.42 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]-phenylmethyl]-5-methylthiophene-2-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]-phenylmethyl]-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 16561484 |
| Molecular Formula | C20H17F2NO2S |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]-phenylmethyl]-5-methylthiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccccc2)c2ccc(OC(F)F)cc2)s1 |
| InChI | InChI=1S/C20H17F2NO2S/c1-13-7-12-17(26-13)19(24)23-18(14-5-3-2-4-6-14)15-8-10-16(11-9-15)25-20(21)22/h2-12,18,20H,1H3,(H,23,24) |
| InChIKey | HCPNPAXIYBBWAA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |