C24H25NO3S — CID 46433418
N-[(4-ethoxyphenyl)-phenylmethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide (PubChem CID 46433418) has the molecular formula C24H25NO3S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-[(4-ethoxyphenyl)-phenylmethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[(4-ethoxyphenyl)-phenylmethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 46433418 |
| Molecular Formula | C24H25NO3S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[(4-ethoxyphenyl)-phenylmethyl]-4-(5-methylthiophen-2-yl)-4-oxobutanamide |
| SMILES | CCOc1ccc(C(NC(=O)CCC(=O)c2ccc(C)s2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO3S/c1-3-28-20-12-10-19(11-13-20)24(18-7-5-4-6-8-18)25-23(27)16-14-21(26)22-15-9-17(2)29-22/h4-13,15,24H,3,14,16H2,1-2H3,(H,25,27) |
| InChIKey | VFYZMBONTUQXEK-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |