C20H25NO3S — CID 55713603
4-(5-methylthiophen-2-yl)-4-oxo-N-[1-(3-propan-2-yloxyphenyl)ethyl]butanamide (PubChem CID 55713603) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is 4-(5-methylthiophen-2-yl)-4-oxo-N-[1-(3-propan-2-yloxyphenyl)ethyl]butanamide.
| Compound Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[1-(3-propan-2-yloxyphenyl)ethyl]butanamide |
|---|---|
| PubChem CID | 55713603 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-(5-methylthiophen-2-yl)-4-oxo-N-[1-(3-propan-2-yloxyphenyl)ethyl]butanamide |
| SMILES | Cc1ccc(C(=O)CCC(=O)NC(C)c2cccc(OC(C)C)c2)s1 |
| InChI | InChI=1S/C20H25NO3S/c1-13(2)24-17-7-5-6-16(12-17)15(4)21-20(23)11-9-18(22)19-10-8-14(3)25-19/h5-8,10,12-13,15H,9,11H2,1-4H3,(H,21,23) |
| InChIKey | UEJBPDKJMBFSLZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |