C21H16ClF2NO2 — CID 25440599
3-chloro-N-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]benzamide (PubChem CID 25440599) has the molecular formula C21H16ClF2NO2 and a molecular weight of 387.81 g/mol. Its IUPAC name is 3-chloro-N-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]benzamide.
| Compound Name | 3-chloro-N-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]benzamide |
|---|---|
| PubChem CID | 25440599 |
| Molecular Formula | C21H16ClF2NO2 |
| Molecular Weight | 387.81 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | 3-chloro-N-[(S)-[4-(difluoromethoxy)phenyl]-phenylmethyl]benzamide |
| SMILES | O=C(N[C@@H](c1ccccc1)c1ccc(OC(F)F)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C21H16ClF2NO2/c22-17-8-4-7-16(13-17)20(26)25-19(14-5-2-1-3-6-14)15-9-11-18(12-10-15)27-21(23)24/h1-13,19,21H,(H,25,26)/t19-/m0/s1 |
| InChIKey | TXOKVIYLPPXAIA-IBGZPJMESA-N |
| XLogP | 5.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.81 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |