C13H18N2O4S2 — CID 30829913
methyl (3S)-3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate (PubChem CID 30829913) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is methyl (3S)-3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate.
| Compound Name | methyl (3S)-3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate |
|---|---|
| PubChem CID | 30829913 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl (3S)-3-[3-(2-amino-2-oxoethyl)sulfanylpropanoylamino]-3-thiophen-2-ylpropanoate |
| SMILES | COC(=O)C[C@H](NC(=O)CCSCC(N)=O)c1cccs1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-19-13(18)7-9(10-3-2-5-21-10)15-12(17)4-6-20-8-11(14)16/h2-3,5,9H,4,6-8H2,1H3,(H2,14,16)(H,15,17)/t9-/m0/s1 |
| InChIKey | QBAAEUDIZYVOSO-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|