C15H29NO7 — CID 158746173
molecular hydrogen;8-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]octanoic acid (PubChem CID 158746173) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is molecular hydrogen;8-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]octanoic acid.
| Compound Name | molecular hydrogen;8-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]octanoic acid |
|---|---|
| PubChem CID | 158746173 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | molecular hydrogen;8-[[(3R,5R)-1,3,4,5-tetrahydroxycyclohexanecarbonyl]amino]octanoic acid |
| SMILES | O=C(O)CCCCCCCNC(=O)C1(O)C[C@@H](O)C(O)[C@H](O)C1.[H][H] |
| InChI | InChI=1S/C15H27NO7.H2/c17-10-8-15(23,9-11(18)13(10)21)14(22)16-7-5-3-1-2-4-6-12(19)20;/h10-11,13,17-18,21,23H,1-9H2,(H,16,22)(H,19,20);1H/t10-,11-,13?,15?;/m1./s1 |
| InChIKey | IMXJLVOLTSOYHG-VSHYHHEKSA-N |
| XLogP | -0.62 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|