C12H19F2NO3 — CID 122107729
7-[(2,2-difluoro-1-methylcyclopropanecarbonyl)amino]heptanoic acid (PubChem CID 122107729) has the molecular formula C12H19F2NO3 and a molecular weight of 263.28 g/mol. Its IUPAC name is 7-[(2,2-difluoro-1-methylcyclopropanecarbonyl)amino]heptanoic acid.
| Compound Name | 7-[(2,2-difluoro-1-methylcyclopropanecarbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 122107729 |
| Molecular Formula | C12H19F2NO3 |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 7-[(2,2-difluoro-1-methylcyclopropanecarbonyl)amino]heptanoic acid |
| SMILES | CC1(C(=O)NCCCCCCC(=O)O)CC1(F)F |
| InChI | InChI=1S/C12H19F2NO3/c1-11(8-12(11,13)14)10(18)15-7-5-3-2-4-6-9(16)17/h2-8H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | RVXSYIZBGWTOOD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|