C29H58N2O6 — CID 156732103
ethane;10-(propanoylamino)decanoic acid;11-(propanoylamino)undecanoic acid (PubChem CID 156732103) has the molecular formula C29H58N2O6 and a molecular weight of 530.79 g/mol. Its IUPAC name is ethane;10-(propanoylamino)decanoic acid;11-(propanoylamino)undecanoic acid.
| Compound Name | ethane;10-(propanoylamino)decanoic acid;11-(propanoylamino)undecanoic acid |
|---|---|
| PubChem CID | 156732103 |
| Molecular Formula | C29H58N2O6 |
| Molecular Weight | 530.79 g/mol |
| Exact Mass | 530.43 |
| IUPAC Name | ethane;10-(propanoylamino)decanoic acid;11-(propanoylamino)undecanoic acid |
| SMILES | CC.CCC(=O)NCCCCCCCCCC(=O)O.CCC(=O)NCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H27NO3.C13H25NO3.C2H6/c1-2-13(16)15-12-10-8-6-4-3-5-7-9-11-14(17)18;1-2-12(15)14-11-9-7-5-3-4-6-8-10-13(16)17;1-2/h2-12H2,1H3,(H,15,16)(H,17,18);2-11H2,1H3,(H,14,15)(H,16,17);1-2H3 |
| InChIKey | BHXRWKVJWZAEKS-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.79 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|