C14H24N2O4S2 — CID 3033251
6-[[2-(5-carboxypentylamino)-2-sulfanylideneethanethioyl]amino]hexanoic acid (PubChem CID 3033251) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 6-[[2-(5-carboxypentylamino)-2-sulfanylideneethanethioyl]amino]hexanoic acid.
| Compound Name | 6-[[2-(5-carboxypentylamino)-2-sulfanylideneethanethioyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 3033251 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 6-[[2-(5-carboxypentylamino)-2-sulfanylideneethanethioyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=S)C(=S)NCCCCCC(=O)O |
| InChI | InChI=1S/C14H24N2O4S2/c17-11(18)7-3-1-5-9-15-13(21)14(22)16-10-6-2-4-8-12(19)20/h1-10H2,(H,15,21)(H,16,22)(H,17,18)(H,19,20) |
| InChIKey | ULDWLRACFAJMJC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|