C7H11N3OS — CID 130652199
2-(5-methyl-1,3-thiazol-2-yl)ethylurea (PubChem CID 130652199) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(5-methyl-1,3-thiazol-2-yl)ethylurea.
| Compound Name | 2-(5-methyl-1,3-thiazol-2-yl)ethylurea |
|---|---|
| PubChem CID | 130652199 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 2-(5-methyl-1,3-thiazol-2-yl)ethylurea |
| SMILES | Cc1cnc(CCNC(N)=O)s1 |
| InChI | InChI=1S/C7H11N3OS/c1-5-4-10-6(12-5)2-3-9-7(8)11/h4H,2-3H2,1H3,(H3,8,9,11) |
| InChIKey | UJAOMHSKZDMJPK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |