C7H10N2OS — CID 69134787
3-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 69134787) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 69134787 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | Cc1cnc(CCC(N)=O)s1 |
| InChI | InChI=1S/C7H10N2OS/c1-5-4-9-7(11-5)3-2-6(8)10/h4H,2-3H2,1H3,(H2,8,10) |
| InChIKey | WPPVIQGGHMLTQL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |