C9H15N3OS — CID 103814822
4-amino-N-[(5-methyl-1,3-thiazol-2-yl)methyl]butanamide (PubChem CID 103814822) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 4-amino-N-[(5-methyl-1,3-thiazol-2-yl)methyl]butanamide.
| Compound Name | 4-amino-N-[(5-methyl-1,3-thiazol-2-yl)methyl]butanamide |
|---|---|
| PubChem CID | 103814822 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 4-amino-N-[(5-methyl-1,3-thiazol-2-yl)methyl]butanamide |
| SMILES | Cc1cnc(CNC(=O)CCCN)s1 |
| InChI | InChI=1S/C9H15N3OS/c1-7-5-12-9(14-7)6-11-8(13)3-2-4-10/h5H,2-4,6,10H2,1H3,(H,11,13) |
| InChIKey | BXPONOAPTGVEHW-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |