C11H13N3OS3 — CID 113241736
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]acetamide (PubChem CID 113241736) has the molecular formula C11H13N3OS3 and a molecular weight of 299.45 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]acetamide.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 113241736 |
| Molecular Formula | C11H13N3OS3 |
| Molecular Weight | 299.45 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]acetamide |
| SMILES | Cc1cnc(CNC(=O)Cc2sc(=S)[nH]c2C)s1 |
| InChI | InChI=1S/C11H13N3OS3/c1-6-4-13-10(17-6)5-12-9(15)3-8-7(2)14-11(16)18-8/h4H,3,5H2,1-2H3,(H,12,15)(H,14,16) |
| InChIKey | BHJLFEQXGDPUIU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.45 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|