C11H16N2OS2 — CID 47125331
N-cyclopentyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 47125331) has the molecular formula C11H16N2OS2 and a molecular weight of 256.40 g/mol. Its IUPAC name is N-cyclopentyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-cyclopentyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 47125331 |
| Molecular Formula | C11H16N2OS2 |
| Molecular Weight | 256.40 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | N-cyclopentyl-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)NC1CCCC1 |
| InChI | InChI=1S/C11H16N2OS2/c1-7-9(16-11(15)12-7)6-10(14)13-8-4-2-3-5-8/h8H,2-6H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | XAELYZHEPODWMJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|