C14H22N2OS2 — CID 107031075
N-(3-ethyl-2-methylcyclopentyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 107031075) has the molecular formula C14H22N2OS2 and a molecular weight of 298.48 g/mol. Its IUPAC name is N-(3-ethyl-2-methylcyclopentyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(3-ethyl-2-methylcyclopentyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 107031075 |
| Molecular Formula | C14H22N2OS2 |
| Molecular Weight | 298.48 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | N-(3-ethyl-2-methylcyclopentyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | CCC1CCC(NC(=O)Cc2sc(=S)[nH]c2C)C1C |
| InChI | InChI=1S/C14H22N2OS2/c1-4-10-5-6-11(8(10)2)16-13(17)7-12-9(3)15-14(18)19-12/h8,10-11H,4-7H2,1-3H3,(H,15,18)(H,16,17) |
| InChIKey | FZYNQKRZXHIBCS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.48 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|