C15H24N2O2S2 — CID 99636177
N-[3-[(1R,2R)-2-hydroxycyclohexyl]propyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 99636177) has the molecular formula C15H24N2O2S2 and a molecular weight of 328.50 g/mol. Its IUPAC name is N-[3-[(1R,2R)-2-hydroxycyclohexyl]propyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[3-[(1R,2R)-2-hydroxycyclohexyl]propyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 99636177 |
| Molecular Formula | C15H24N2O2S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | N-[3-[(1R,2R)-2-hydroxycyclohexyl]propyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1[nH]c(=S)sc1CC(=O)NCCC[C@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C15H24N2O2S2/c1-10-13(21-15(20)17-10)9-14(19)16-8-4-6-11-5-2-3-7-12(11)18/h11-12,18H,2-9H2,1H3,(H,16,19)(H,17,20)/t11-,12-/m1/s1 |
| InChIKey | BKGLENWXYJLZPG-VXGBXAGGSA-N |
| XLogP | 3.10 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|