C13H23N3OS2 — CID 103719302
N-[2-[ethyl(propyl)amino]ethyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 103719302) has the molecular formula C13H23N3OS2 and a molecular weight of 301.48 g/mol. Its IUPAC name is N-[2-[ethyl(propyl)amino]ethyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[2-[ethyl(propyl)amino]ethyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 103719302 |
| Molecular Formula | C13H23N3OS2 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[2-[ethyl(propyl)amino]ethyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | CCCN(CC)CCNC(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C13H23N3OS2/c1-4-7-16(5-2)8-6-14-12(17)9-11-10(3)15-13(18)19-11/h4-9H2,1-3H3,(H,14,17)(H,15,18) |
| InChIKey | YZZGHMAFHSQNIX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|