C11H18N2OS2 — CID 47128474
2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-pentylacetamide (PubChem CID 47128474) has the molecular formula C11H18N2OS2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-pentylacetamide.
| Compound Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-pentylacetamide |
|---|---|
| PubChem CID | 47128474 |
| Molecular Formula | C11H18N2OS2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)-N-pentylacetamide |
| SMILES | CCCCCNC(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C11H18N2OS2/c1-3-4-5-6-12-10(14)7-9-8(2)13-11(15)16-9/h3-7H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | LSDWYQBAHNQMPG-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|