C13H13BrN2OS2 — CID 107033225
N-(2-bromo-3-methylphenyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 107033225) has the molecular formula C13H13BrN2OS2 and a molecular weight of 357.30 g/mol. Its IUPAC name is N-(2-bromo-3-methylphenyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-(2-bromo-3-methylphenyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 107033225 |
| Molecular Formula | C13H13BrN2OS2 |
| Molecular Weight | 357.30 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | N-(2-bromo-3-methylphenyl)-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cc2sc(=S)[nH]c2C)c1Br |
| InChI | InChI=1S/C13H13BrN2OS2/c1-7-4-3-5-9(12(7)14)16-11(17)6-10-8(2)15-13(18)19-10/h3-5H,6H2,1-2H3,(H,15,18)(H,16,17) |
| InChIKey | RVBZOIXYRJJJLA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|