C15H18N2O2S2 — CID 102978274
N-[2-(2-methoxyethyl)phenyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide (PubChem CID 102978274) has the molecular formula C15H18N2O2S2 and a molecular weight of 322.46 g/mol. Its IUPAC name is N-[2-(2-methoxyethyl)phenyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide.
| Compound Name | N-[2-(2-methoxyethyl)phenyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
|---|---|
| PubChem CID | 102978274 |
| Molecular Formula | C15H18N2O2S2 |
| Molecular Weight | 322.46 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-[2-(2-methoxyethyl)phenyl]-2-(4-methyl-2-sulfanylidene-3H-1,3-thiazol-5-yl)acetamide |
| SMILES | COCCc1ccccc1NC(=O)Cc1sc(=S)[nH]c1C |
| InChI | InChI=1S/C15H18N2O2S2/c1-10-13(21-15(20)16-10)9-14(18)17-12-6-4-3-5-11(12)7-8-19-2/h3-6H,7-9H2,1-2H3,(H,16,20)(H,17,18) |
| InChIKey | ZUCQJCGSOJEQTR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|