C12H17NO3 — CID 70333510
2-hydroxy-N-[2-(3-methoxypropyl)phenyl]acetamide (PubChem CID 70333510) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-hydroxy-N-[2-(3-methoxypropyl)phenyl]acetamide.
| Compound Name | 2-hydroxy-N-[2-(3-methoxypropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 70333510 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-hydroxy-N-[2-(3-methoxypropyl)phenyl]acetamide |
| SMILES | COCCCc1ccccc1NC(=O)CO |
| InChI | InChI=1S/C12H17NO3/c1-16-8-4-6-10-5-2-3-7-11(10)13-12(15)9-14/h2-3,5,7,14H,4,6,8-9H2,1H3,(H,13,15) |
| InChIKey | NUTCIOVRSDSVSP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|