C16H26N2O2 — CID 102905725
3-amino-N-[2-(2-methoxyethyl)phenyl]-2,2,3-trimethylbutanamide (PubChem CID 102905725) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 3-amino-N-[2-(2-methoxyethyl)phenyl]-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-[2-(2-methoxyethyl)phenyl]-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 102905725 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 3-amino-N-[2-(2-methoxyethyl)phenyl]-2,2,3-trimethylbutanamide |
| SMILES | COCCc1ccccc1NC(=O)C(C)(C)C(C)(C)N |
| InChI | InChI=1S/C16H26N2O2/c1-15(2,16(3,4)17)14(19)18-13-9-7-6-8-12(13)10-11-20-5/h6-9H,10-11,17H2,1-5H3,(H,18,19) |
| InChIKey | QBNIWJYNRHUFNL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |