C13H19N3O3 — CID 102903270
N-(2-aminoethyl)-N'-[2-(2-methoxyethyl)phenyl]oxamide (PubChem CID 102903270) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-[2-(2-methoxyethyl)phenyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-[2-(2-methoxyethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 102903270 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | N-(2-aminoethyl)-N'-[2-(2-methoxyethyl)phenyl]oxamide |
| SMILES | COCCc1ccccc1NC(=O)C(=O)NCCN |
| InChI | InChI=1S/C13H19N3O3/c1-19-9-6-10-4-2-3-5-11(10)16-13(18)12(17)15-8-7-14/h2-5H,6-9,14H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | OLRHWNORQXWDTO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|