C14H20N2O4 — CID 102907562
ethyl 2-[[2-(2-methoxyethyl)phenyl]carbamoylamino]acetate (PubChem CID 102907562) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is ethyl 2-[[2-(2-methoxyethyl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[2-(2-methoxyethyl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 102907562 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | ethyl 2-[[2-(2-methoxyethyl)phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccccc1CCOC |
| InChI | InChI=1S/C14H20N2O4/c1-3-20-13(17)10-15-14(18)16-12-7-5-4-6-11(12)8-9-19-2/h4-7H,3,8-10H2,1-2H3,(H2,15,16,18) |
| InChIKey | JGOINMIKUJCEAL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |