C18H19N3O4 — CID 12735876
ethyl 2-[[2-(phenylcarbamoyl)phenyl]carbamoylamino]acetate (PubChem CID 12735876) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is ethyl 2-[[2-(phenylcarbamoyl)phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[2-(phenylcarbamoyl)phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 12735876 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | ethyl 2-[[2-(phenylcarbamoyl)phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C18H19N3O4/c1-2-25-16(22)12-19-18(24)21-15-11-7-6-10-14(15)17(23)20-13-8-4-3-5-9-13/h3-11H,2,12H2,1H3,(H,20,23)(H2,19,21,24) |
| InChIKey | NALZRZNZPODYOB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |