C23H29N3O4 — CID 71857054
methyl 3-ethyl-3-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]amino]pentanoate (PubChem CID 71857054) has the molecular formula C23H29N3O4 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl 3-ethyl-3-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]amino]pentanoate.
| Compound Name | methyl 3-ethyl-3-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]amino]pentanoate |
|---|---|
| PubChem CID | 71857054 |
| Molecular Formula | C23H29N3O4 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | methyl 3-ethyl-3-[[2-oxo-2-[2-(phenylcarbamoyl)anilino]ethyl]amino]pentanoate |
| SMILES | CCC(CC)(CC(=O)OC)NCC(=O)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H29N3O4/c1-4-23(5-2,15-21(28)30-3)24-16-20(27)26-19-14-10-9-13-18(19)22(29)25-17-11-7-6-8-12-17/h6-14,24H,4-5,15-16H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | CCQMHBWXUAYGTR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |