C25H24N4O4S — CID 4942197
methyl 4-[[2-[(4-anilinophenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 4942197) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is methyl 4-[[2-[(4-anilinophenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | methyl 4-[[2-[(4-anilinophenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4942197 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | methyl 4-[[2-[(4-anilinophenyl)carbamoyl]phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)NC(=S)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N4O4S/c1-33-23(31)16-15-22(30)29-25(34)28-21-10-6-5-9-20(21)24(32)27-19-13-11-18(12-14-19)26-17-7-3-2-4-8-17/h2-14,26H,15-16H2,1H3,(H,27,32)(H2,28,29,30,34) |
| InChIKey | SAAIKVAGJDFGBU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 108.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|