C15H22N4O3 — CID 59648075
ethyl 2-[(2-piperazin-1-ylphenyl)carbamoylamino]acetate (PubChem CID 59648075) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is ethyl 2-[(2-piperazin-1-ylphenyl)carbamoylamino]acetate.
| Compound Name | ethyl 2-[(2-piperazin-1-ylphenyl)carbamoylamino]acetate |
|---|---|
| PubChem CID | 59648075 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | ethyl 2-[(2-piperazin-1-ylphenyl)carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccccc1N1CCNCC1 |
| InChI | InChI=1S/C15H22N4O3/c1-2-22-14(20)11-17-15(21)18-12-5-3-4-6-13(12)19-9-7-16-8-10-19/h3-6,16H,2,7-11H2,1H3,(H2,17,18,21) |
| InChIKey | IVQUNTTWFIFONQ-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |