C15H22N2O2 — CID 54921193
ethyl 2-[(2-pyrrolidin-1-ylphenyl)methylamino]acetate (PubChem CID 54921193) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl 2-[(2-pyrrolidin-1-ylphenyl)methylamino]acetate.
| Compound Name | ethyl 2-[(2-pyrrolidin-1-ylphenyl)methylamino]acetate |
|---|---|
| PubChem CID | 54921193 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethyl 2-[(2-pyrrolidin-1-ylphenyl)methylamino]acetate |
| SMILES | CCOC(=O)CNCc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C15H22N2O2/c1-2-19-15(18)12-16-11-13-7-3-4-8-14(13)17-9-5-6-10-17/h3-4,7-8,16H,2,5-6,9-12H2,1H3 |
| InChIKey | XWESSDYORSAPCM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |