C15H24N2O — CID 43778380
2-ethoxy-N-[(2-pyrrolidin-1-ylphenyl)methyl]ethanamine (PubChem CID 43778380) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-ethoxy-N-[(2-pyrrolidin-1-ylphenyl)methyl]ethanamine.
| Compound Name | 2-ethoxy-N-[(2-pyrrolidin-1-ylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 43778380 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-ethoxy-N-[(2-pyrrolidin-1-ylphenyl)methyl]ethanamine |
| SMILES | CCOCCNCc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C15H24N2O/c1-2-18-12-9-16-13-14-7-3-4-8-15(14)17-10-5-6-11-17/h3-4,7-8,16H,2,5-6,9-13H2,1H3 |
| InChIKey | SHUPQUHZNJMWCD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|