C20H23NO4 — CID 11702879
2-[5-[2-[(2-hydroxyacetyl)amino]phenyl]pentyl]benzoic acid (PubChem CID 11702879) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-[5-[2-[(2-hydroxyacetyl)amino]phenyl]pentyl]benzoic acid.
| Compound Name | 2-[5-[2-[(2-hydroxyacetyl)amino]phenyl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 11702879 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[5-[2-[(2-hydroxyacetyl)amino]phenyl]pentyl]benzoic acid |
| SMILES | O=C(CO)Nc1ccccc1CCCCCc1ccccc1C(=O)O |
| InChI | InChI=1S/C20H23NO4/c22-14-19(23)21-18-13-7-5-11-16(18)10-3-1-2-8-15-9-4-6-12-17(15)20(24)25/h4-7,9,11-13,22H,1-3,8,10,14H2,(H,21,23)(H,24,25) |
| InChIKey | YXAXNDXHCACNAB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|