C25H24F3NO4S — CID 68691951
2-[5-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]pentyl]benzoic acid (PubChem CID 68691951) has the molecular formula C25H24F3NO4S and a molecular weight of 491.53 g/mol. Its IUPAC name is 2-[5-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]pentyl]benzoic acid.
| Compound Name | 2-[5-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 68691951 |
| Molecular Formula | C25H24F3NO4S |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 2-[5-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]pentyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCCCc1ccccc1NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C25H24F3NO4S/c26-25(27,28)21-15-7-9-17-23(21)34(32,33)29-22-16-8-5-13-19(22)12-3-1-2-10-18-11-4-6-14-20(18)24(30)31/h4-9,11,13-17,29H,1-3,10,12H2,(H,30,31) |
| InChIKey | MIAJZUADIGTWRL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|