C27H26N2O4S — CID 11525761
2-[5-[2-(quinolin-8-ylsulfonylamino)phenyl]pentyl]benzoic acid (PubChem CID 11525761) has the molecular formula C27H26N2O4S and a molecular weight of 474.58 g/mol. Its IUPAC name is 2-[5-[2-(quinolin-8-ylsulfonylamino)phenyl]pentyl]benzoic acid.
| Compound Name | 2-[5-[2-(quinolin-8-ylsulfonylamino)phenyl]pentyl]benzoic acid |
|---|---|
| PubChem CID | 11525761 |
| Molecular Formula | C27H26N2O4S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 2-[5-[2-(quinolin-8-ylsulfonylamino)phenyl]pentyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCCCc1ccccc1NS(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C27H26N2O4S/c30-27(31)23-16-6-4-11-20(23)10-2-1-3-12-21-13-5-7-17-24(21)29-34(32,33)25-18-8-14-22-15-9-19-28-26(22)25/h4-9,11,13-19,29H,1-3,10,12H2,(H,30,31) |
| InChIKey | AWBHZCHRVFUYEN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|