C19H23N3O4S — CID 90727760
ethane;2-(quinoxalin-5-ylsulfonylamino)benzoic acid (PubChem CID 90727760) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is ethane;2-(quinoxalin-5-ylsulfonylamino)benzoic acid.
| Compound Name | ethane;2-(quinoxalin-5-ylsulfonylamino)benzoic acid |
|---|---|
| PubChem CID | 90727760 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethane;2-(quinoxalin-5-ylsulfonylamino)benzoic acid |
| SMILES | CC.CC.O=C(O)c1ccccc1NS(=O)(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C15H11N3O4S.2C2H6/c19-15(20)10-4-1-2-5-11(10)18-23(21,22)13-7-3-6-12-14(13)17-9-8-16-12;2*1-2/h1-9,18H,(H,19,20);2*1-2H3 |
| InChIKey | FUCAFGGABGGXRK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 109.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |