C17H12F3N3O4S — CID 67200346
methyl 2-(quinoxalin-5-ylsulfonylamino)-4-(trifluoromethyl)benzoate (PubChem CID 67200346) has the molecular formula C17H12F3N3O4S and a molecular weight of 411.36 g/mol. Its IUPAC name is methyl 2-(quinoxalin-5-ylsulfonylamino)-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-(quinoxalin-5-ylsulfonylamino)-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 67200346 |
| Molecular Formula | C17H12F3N3O4S |
| Molecular Weight | 411.36 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | methyl 2-(quinoxalin-5-ylsulfonylamino)-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)cc1NS(=O)(=O)c1cccc2nccnc12 |
| InChI | InChI=1S/C17H12F3N3O4S/c1-27-16(24)11-6-5-10(17(18,19)20)9-13(11)23-28(25,26)14-4-2-3-12-15(14)22-8-7-21-12/h2-9,23H,1H3 |
| InChIKey | ONGLEOSTGIYRQZ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.36 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |