C16H11F3N2O4S — CID 151445715
methyl 2-[(4-cyanophenyl)sulfonylamino]-4-(trifluoromethyl)benzoate (PubChem CID 151445715) has the molecular formula C16H11F3N2O4S and a molecular weight of 384.34 g/mol. Its IUPAC name is methyl 2-[(4-cyanophenyl)sulfonylamino]-4-(trifluoromethyl)benzoate.
| Compound Name | methyl 2-[(4-cyanophenyl)sulfonylamino]-4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 151445715 |
| Molecular Formula | C16H11F3N2O4S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | methyl 2-[(4-cyanophenyl)sulfonylamino]-4-(trifluoromethyl)benzoate |
| SMILES | COC(=O)c1ccc(C(F)(F)F)cc1NS(=O)(=O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H11F3N2O4S/c1-25-15(22)13-7-4-11(16(17,18)19)8-14(13)21-26(23,24)12-5-2-10(9-20)3-6-12/h2-8,21H,1H3 |
| InChIKey | PFLAHXSJSVUOOY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |