C19H16N2O6S — CID 24502183
dimethyl 2-(quinolin-8-ylsulfamoyl)benzene-1,4-dicarboxylate (PubChem CID 24502183) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is dimethyl 2-(quinolin-8-ylsulfamoyl)benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-(quinolin-8-ylsulfamoyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 24502183 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | dimethyl 2-(quinolin-8-ylsulfamoyl)benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)Nc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C19H16N2O6S/c1-26-18(22)13-8-9-14(19(23)27-2)16(11-13)28(24,25)21-15-7-3-5-12-6-4-10-20-17(12)15/h3-11,21H,1-2H3 |
| InChIKey | HFGVVIUOISWMGP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |