C18H19NO6S — CID 26952290
dimethyl 2-[(3,4-dimethylphenyl)sulfamoyl]benzene-1,4-dicarboxylate (PubChem CID 26952290) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is dimethyl 2-[(3,4-dimethylphenyl)sulfamoyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(3,4-dimethylphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 26952290 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | dimethyl 2-[(3,4-dimethylphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C18H19NO6S/c1-11-5-7-14(9-12(11)2)19-26(22,23)16-10-13(17(20)24-3)6-8-15(16)18(21)25-4/h5-10,19H,1-4H3 |
| InChIKey | ZCMZPAGUKFWZRX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |