C17H16INO6S — CID 26950536
dimethyl 2-[(3-iodo-4-methylphenyl)sulfamoyl]benzene-1,4-dicarboxylate (PubChem CID 26950536) has the molecular formula C17H16INO6S and a molecular weight of 489.29 g/mol. Its IUPAC name is dimethyl 2-[(3-iodo-4-methylphenyl)sulfamoyl]benzene-1,4-dicarboxylate.
| Compound Name | dimethyl 2-[(3-iodo-4-methylphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 26950536 |
| Molecular Formula | C17H16INO6S |
| Molecular Weight | 489.29 g/mol |
| Exact Mass | 488.97 |
| IUPAC Name | dimethyl 2-[(3-iodo-4-methylphenyl)sulfamoyl]benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(S(=O)(=O)Nc2ccc(C)c(I)c2)c1 |
| InChI | InChI=1S/C17H16INO6S/c1-10-4-6-12(9-14(10)18)19-26(22,23)15-8-11(16(20)24-2)5-7-13(15)17(21)25-3/h4-9,19H,1-3H3 |
| InChIKey | DWMYBOFEHLIMQX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|