C23H20F3NO4S — CID 68691483
2-[3-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]propyl]benzoic acid (PubChem CID 68691483) has the molecular formula C23H20F3NO4S and a molecular weight of 463.48 g/mol. Its IUPAC name is 2-[3-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]propyl]benzoic acid.
| Compound Name | 2-[3-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]propyl]benzoic acid |
|---|---|
| PubChem CID | 68691483 |
| Molecular Formula | C23H20F3NO4S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 2-[3-[2-[[2-(trifluoromethyl)phenyl]sulfonylamino]phenyl]propyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1CCCc1ccccc1NS(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H20F3NO4S/c24-23(25,26)19-13-4-6-15-21(19)32(30,31)27-20-14-5-2-9-17(20)11-7-10-16-8-1-3-12-18(16)22(28)29/h1-6,8-9,12-15,27H,7,10-11H2,(H,28,29) |
| InChIKey | IBZHAAQUADTECA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |